# Visualization chemFilters includes `MolPlotter` and `MolGridPlotter` for rendering molecules with RDKit's `MolDraw2DCairo`. Both classes support extensive customization of the rendering process through constructor parameters and RDKit draw options. ## Single molecule rendering `MolPlotter` renders individual molecules as PIL images or SVG strings. ```python from rdkit import Chem from chemFilters.img_render import MolPlotter mol = Chem.MolFromSmiles("CC(=O)Oc1ccccc1C(=O)O") plotter = MolPlotter(from_smi=False, size=(400, 400)) img = plotter.render_mol(mol, label="Aspirin") ``` ```{image} /_static/figures/visualization/single_mol.png :alt: Single molecule rendering of aspirin :width: 400px ``` ### SVG output Pass `return_svg=True` to get an SVG string instead of a PIL image: ```python svg_text = plotter.render_mol(mol, label="Aspirin", return_svg=True) ``` ### ACS 1996 style Render molecules following the American Chemical Society (ACS) 1996 drawing standards. Because ACS 1996 enforces fixed bond lengths, the molecule size on the canvas is determined by the standard rather than the `size` parameter. Passing a large fixed size will result in blank space around the structure. Using `size=(-1, -1)` for a flexible canvas (see [Flexible canvas](#flexible-canvas)) avoids this, but produces a small image since bond lengths are fixed. Use `label_font_size` to keep the label proportional: ```python plotter = MolPlotter(from_smi=False, size=(-1, -1), label_font_size=8) img = plotter.render_ACS1996(mol, label="Aspirin") ``` ```{image} /_static/figures/visualization/acs1996.svg :alt: Aspirin rendered in ACS 1996 style :width: 300px ``` ### Pose matching Align a molecule's 2D depiction to a reference structure using `match_pose`. This accepts SMILES, SMARTS, or an `rdkit.Chem.Mol` object: ```python img = plotter.render_mol(mol, match_pose="c1ccccc1") ``` ## Molecule grids `MolGridPlotter` extends `MolPlotter` to arrange multiple molecules into a grid image. ```python from chemFilters.img_render import MolGridPlotter mols = [ Chem.MolFromSmiles("CCC1=[O+][Cu-3]2([O+]=C(CC)C1)[O+]=C(CC)CC(CC)=[O+]2"), Chem.MolFromSmiles("CC1=C2C(=COC(C)C2C)C(O)=C(C(=O)O)C1=O"), Chem.MolFromSmiles("CCOP(=O)(Nc1cccc(Cl)c1)OCC"), Chem.MolFromSmiles("Nc1ccc(C=Cc2ccc(N)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1"), ] labels = [f"Molecule {i}" for i in range(1, len(mols) + 1)] grid_plotter = MolGridPlotter(from_smi=False, font_name="Telex-Regular") img = grid_plotter.mol_grid_png(mols, n_cols=2, labels=labels) ``` ```{image} /_static/figures/visualization/simple_grid.png :alt: 2x2 molecule grid with labels :width: 500px ``` ## Substructure match highlighting After filtering molecules with `RdkitFilters`, you can highlight the matched substructures on a grid: ```python from chemFilters import RdkitFilters chemFilter = RdkitFilters(filter_type="ALL") filter_names, descriptions, substructs = chemFilter.filter_mols(mols) grid_plotter = MolGridPlotter( from_smi=False, font_name="Telex-Regular", size=(250, 250) ) img = grid_plotter.mol_structmatch_grid_png(mols, substructs=substructs, n_cols=2) ``` ```{image} /_static/figures/visualization/substruct_grid.png :alt: Molecule grid with highlighted substructure matches :width: 500px ``` For a single molecule, use `render_with_matches` directly: ```python plotter = MolPlotter(from_smi=False) img = plotter.render_with_matches( mols[0], substructs=substructs[0], label="Molecule 1" ) ``` ## Colored substructure matches Each matched substructure can be rendered in a different color. When substructures overlap, the colors are blended using their geometric mean. ```python import matplotlib.pyplot as plt from chemFilters.img_render import MolPlotter chemFilter = RdkitFilters(filter_type="NIH") filter_names, descriptions, substructs = chemFilter.filter_mols(mols) plotter = MolPlotter( from_smi=False, label_font_size=20, size=(350, 350), font_name="Telex-Regular" ) img = plotter.render_with_colored_matches( mols[0], descriptions=descriptions[0], substructs=substructs[0], label="Molecule 1", alpha=0.3, ) plt.imshow(img) ax = plt.gca() ax.set_axis_off() plotter.colored_matches_legend(descriptions[0], substructs[0], ax=ax) ``` ```{image} /_static/figures/visualization/colored_matches.png :alt: Colored substructure match highlighting with legend :width: 500px ``` For grids with colored matches, use `mol_structmatch_color_grid_png`: ```python grid_plotter = MolGridPlotter(from_smi=False, size=(350, 350)) img = grid_plotter.mol_structmatch_color_grid_png( mols, descriptions=descriptions, substructs=substructs, n_cols=2 ) ``` ### Colormap options The `cmap` parameter controls the colormap used for highlighting substructures. Any matplotlib colormap name is accepted: ```{image} /_static/figures/visualization/cmap_comparison.png :alt: Comparison of rainbow, Set1, and viridis colormaps :width: 700px ``` ## Customizing rendering options Both `MolPlotter` and `MolGridPlotter` expose several options that map to RDKit's `MolDraw2DCairo` settings: | Parameter | Default | Description | |------------------------------|----------------|-------------------------------------------------| | `size` | `(300, 300)` | Image dimensions in pixels; `(-1, -1)` for flexible canvas | | `cmap` | `"rainbow"` | Matplotlib colormap for colored matches | | `font_name` | `"Telex-Regular"` | Font for molecule labels | | `label_font_size` | `None` | Custom font size for labels | | `mol_font_size` | `None` | Custom font size on the molecule drawing | | `annotation_font_scale` | `None` | Scale factor for annotation font size | | `bond_line_width` | `2.0` | Width of bond lines | | `no_atom_labels` | `False` | Suppress atom labels | | `add_atom_indices` | `False` | Display atom indices | | `add_bond_indices` | `False` | Display bond indices | | `explicit_methyl` | `False` | Show methyl groups as CH3 | | `unspecified_stereo_unknown` | `False` | Draw unspecified stereo as unknown | | `bg_transparent` | `False` | Transparent background | | `bw` | `False` | Black-and-white rendering | Additional `MolDraw2D` options can be passed as keyword arguments: ```python plotter = MolPlotter( from_smi=False, size=(500, 500), bw=True, bg_transparent=True, bond_line_width=3.0, ) ``` ### Visual parameter effects (flexible-canvas)= #### Flexible canvas Pass `size=(-1, -1)` to let RDKit auto-size the image to fit the molecule, avoiding blank space around the structure: ```python plotter = MolPlotter(from_smi=False, size=(-1, -1)) img = plotter.render_mol(mol, label="Aspirin") ``` ```{image} /_static/figures/visualization/flexible_canvas.png :alt: Fixed size vs flexible canvas comparison :width: 500px ``` #### Black and white mode ```{image} /_static/figures/visualization/bw_comparison.png :alt: Default vs black and white rendering :width: 700px ``` #### Atom and bond indices ```{image} /_static/figures/visualization/atom_indices.png :alt: Default vs atom indices shown :width: 700px ``` ```{image} /_static/figures/visualization/bond_indices.png :alt: Default vs bond indices shown :width: 700px ``` #### Explicit methyl groups ```{image} /_static/figures/visualization/explicit_methyl.png :alt: Default vs explicit methyl groups :width: 700px ``` #### Suppressing atom labels ```{image} /_static/figures/visualization/no_atom_labels.png :alt: Default vs no atom labels :width: 700px ``` #### Bond line width ```{image} /_static/figures/visualization/bond_line_width.png :alt: Bond line width 1.0, 2.0, and 4.0 comparison :width: 700px ``` #### Transparent background ```{raw} html